Ciwujianoside B (Standard) | CAS | 114902-16-8 |
| Molecular Weight | 1189.34 |
| Formula | C58H92O25 |
| SMILES | O[C@@H]1[C@H](O)[C@@H](O[C@@]2([H])[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O2)[C@]([H])(O[C@@H]3C(C)(C)[C@@](CC[C@]4(C)[C@@]5(CC=C6[C@]4(CC[C@](CC7)(C(O[C@@H]8O[C@H](CO[C@H]9[C@H](O)[C@@H](O)[C@H](O[C@@]%10([H])[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O%10)[C@@H](CO)O9)[C@@H](O)[C@H](O)[C@H]8O)=O)[C@@]6([H])CC7=C)C)[H])([H])[C@]5(C)CC3)OC1 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17927 | Rengyol | Inquiry |
|
| PDP-20504 | 8-Gingerol (Standard) | Inquiry |
|
| PDP-16559 | Dehydro-α-lapachone | Inquiry |
|
| PDP-16367 | Macamide B | Inquiry |
|
| PDP-18762 | Chrysanthellin A | Inquiry |
|
| PDP-13965 | DL-Mannitol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
