Clavariopsin B | CAS No. | 227083-48-9 |
| Molecular Weight | 1140.41 |
| Formula | C58H93N9O14 |
| SMILES | O=C1N2[C@](CCCC2)([H])C(N[C@H](C(N[C@H](C(N([C@H](C(N([C@@](C(N([C@@](C(NCC(N([C@H](C(N[C@H](C(O[C@@H]1C(C)C)=O)CC3=CC=C(C=C3)OC)=O)C(C)C)C)=O)=O)([H])[C@@H](C)CC)C)=O)([H])[C@@H](C)CC)C)=O)CC(O)=O)C)=O)C(C)C)=O)C(C)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11157 | Aureobasidin A | Inquiry |
|
| MDP-23608 | Epoxyquinomicin B | Inquiry |
|
| MDP-23148 | Remisporine B | Inquiry |
|
| MDP-11976 | 1-Heptanol | Inquiry |
|
| MDP-23219 | 7-Methylcoumarin (Standard) | Inquiry |
|
| MDP-22195 | N-Acetylhistidine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
