Cleroindicin F | Synonyms | (-)-Rengyolone |
| CAS | 189264-47-9 |
| Molecular Weight | 154.16 |
| Formula | C8H10O3 |
| SMILES | O[C@]1(C=C2)[C@@](OCC1)([H])CC2=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13661 | Sinapine | Inquiry |
|
| PDP-17093 | Inophyllum B | Inquiry |
|
| PDP-13830 | Karanjin | Inquiry |
|
| PDP-16194 | Entadamide-A-β-D-glucopyranoside | Inquiry |
|
| PDP-13853 | Ophiopogonin D | Inquiry |
|
| PDP-20032 | Colocynthin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
