Clovamide | Synonyms | trans-Clovamide |
| Appearance | Solid |
| CAS | 53755-02-5 |
| Purity | 98.09% |
| Molecular Weight | 359.33 |
| Formula | C18H17NO7 |
| Color | Off-white to light yellow |
| SMILES | OC1=CC=C(C=C1O)/C=C/C(N[C@@H](CC2=CC=C(C(O)=C2)O)C(O)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15191 | Venuloside A | Inquiry |
|
| PDP-18947 | Heteroclitin B | Inquiry |
|
| PDP-18754 | Lycodoline | Inquiry |
|
| PDP-18034 | (E)-Dehydrodiconiferyl Alcohol | Inquiry |
|
| PDP-18421 | Ikshusterol 3-O-glucoside | Inquiry |
|
| PDP-15501 | Piperlonguminine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
