Collismycin B | CAS No. | 158792-25-7 |
| Molecular Weight | 275.33 |
| Formula | C13H13N3O2S |
| SMILES | O/N=C\C1=NC(C2=CC=CC=N2)=CC(OC)=C1SC |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23384 | Carboxin (Standard) | Inquiry |
|
| MDP-24241 | Enamidonin | Inquiry |
|
| MDP-22189 | FR 106969 | Inquiry |
|
| MDP-12216 | D-(+)-Cellobiose (Standard) | Inquiry |
|
| MDP-22832 | Peniciside | Inquiry |
|
| MDP-24279 | 6-O-Demethyl-5-deoxyfusarubin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
