Condurango Glycoside E | CAS | 115784-07-1 |
| Molecular Weight | 1001.16 |
| Formula | C53H76O18 |
| SMILES | CO[C@H]1C[C@H](O[C@H]2CC[C@@]3(C)C(C2)=CC[C@]4(O)[C@]3([H])[C@H](OC(/C=C/C5=CC=CC=C5)=O)[C@@H](OC(C)=O)[C@]6(C)[C@]4(O)CC[C@@H]6C(C)=O)O[C@H](C)[C@H]1O[C@@H]7O[C@H](C)[C@@H](O[C@@H]8O[C@H](C)[C@@H](O)[C@@H](OC)[C@H]8O)[C@H](OC)C7 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16964 | 13-Hydroxylupanine Hydrochloride | Inquiry |
|
| PDP-17805 | Primulagenin A | Inquiry |
|
| PDP-17201 | Isodispar B | Inquiry |
|
| PDP-15736 | Astragaloside IV (Standard) | Inquiry |
|
| PDP-14116 | Wilforlide A | Inquiry |
|
| PDP-16772 | 3-Hydroxyacetophenone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
