(-)-Corynoxidine | Appearance | Solid |
| CAS | 57906-85-1 |
| Purity | 99.90% |
| Molecular Weight | 371.43 |
| Formula | C21H25NO5 |
| Color | Off-white to light yellow |
| SMILES | COC1=CC=C2C(C[N@@+]3([O-])CCC4=CC(OC)=C(OC)C=C4[C@]3([H])C2)=C1OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15440 | 1-Eicosanol | Inquiry |
|
| PDP-13877 | Phillygenin | Inquiry |
|
| PDP-13427 | Stevioside | Inquiry |
|
| PDP-20104 | Amentoflavone Hexaacetate | Inquiry |
|
| PDP-19703 | (±)-5'-Methoxylariciresinol | Inquiry |
|
| PDP-14720 | Loureirin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
