Coumarin 6 | Appearance | Solid |
| CAS | 38215-36-0 |
| Purity | 99.93% |
| Molecular Weight | 350.43 |
| Formula | C20H18N2O2S |
| Color | Yellow to orange |
| SMILES | O=C1C(C2=NC3=CC=CC=C3S2)=CC4=CC=C(N(CC)CC)C=C4O1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20535 | 20(S)-Ginsenoside Rg3 (Standard) | Inquiry |
|
| PDP-20376 | Di-O-methylcrenatin | Inquiry |
|
| PDP-18909 | Retronecine | Inquiry |
|
| PDP-14082 | Higenamine | Inquiry |
|
| PDP-16050 | Sibiricaxanthone B | Inquiry |
|
| PDP-14993 | Dryocrassin ABBA | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
