Cucurbitacin E (Standard) | CAS | 18444-66-1 |
| Molecular Weight | 556.69 |
| Formula | C₃₂H₄₄O₈ |
| SMILES | O[C@H](C1)[C@@]([C@@](C)(O)C(/C=C/C(OC(C)=O)(C)C)=O)([H])[C@](C2)(C)[C@]1(C)[C@]3([H])CC=C4C(C)(C)C(C(O)=C[C@@]4([H])[C@]3(C)C2=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13032 | Grape Seed Extract | Inquiry |
|
| PDP-16367 | Macamide B | Inquiry |
|
| PDP-17921 | Robtein | Inquiry |
|
| PDP-13589 | Kurarinone | Inquiry |
|
| PDP-17549 | Apigenin-6-C-β-D-xylopyranosyl-8-C-α-L-arabinopyranoside | Inquiry |
|
| PDP-13435 | Kaempferide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
