Cucurbitacin I (Standard) | Synonyms | Elatericin B (Standard); JSI-124 (Standard); NSC-521777 (Standard) |
| CAS | 2222-07-3 |
| Molecular Weight | 514.65 |
| Formula | C30H42O7 |
| SMILES | CC(C)(C1=CC[C@@]2([H])[C@@]3(C[C@@H](O)[C@@H]([C@]3(C4)C)[C@@](C)(O)C(/C=C/C(C)(O)C)=O)C)C(C(O)=C[C@@]1([H])[C@]2(C)C4=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13540 | N-trans-Caffeoyltyramine | Inquiry |
|
| PDP-14828 | α-Angelica Lactone | Inquiry |
|
| PDP-19700 | Hydrocotoin | Inquiry |
|
| PDP-20289 | Onitisin | Inquiry |
|
| PDP-19758 | Polygalasaponin F (Standard) | Inquiry |
|
| PDP-15086 | Sanguisorbigenin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
