Curcumol (Standard) | CAS | 4871-97-0 |
| Molecular Weight | 236.35 |
| Formula | C15H24O2 |
| SMILES | O[C@@]1(C2)[C@H](C(C)C)C[C@]3(O1)[C@@H](C)CC[C@@]3([H])C2=C |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13108 | Camptothecin | Inquiry |
|
| PDP-14524 | Ingenol-5,20-acetonide-3-O-angelate | Inquiry |
|
| PDP-14361 | Vitexin-2"-O-rhamnoside | Inquiry |
|
| PDP-14155 | (±)-10-Hydroxycamptothecin | Inquiry |
|
| PDP-19017 | Narchinol B | Inquiry |
|
| PDP-16153 | Notoginsenoside T5 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
