Cyathin A4 | CAS No. | 12626-14-1 |
| Molecular Weight | 334.45 |
| Formula | C20H30O4 |
| SMILES | O=C1C=C(C(CC2C3=C(C(CO)C)CCC3(CCC12C)C)O)CO |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23914 | Chloropolysporin B | Inquiry |
|
| MDP-24316 | Melithiazole K | Inquiry |
|
| MDP-23249 | 2-Naphthol (Standard) | Inquiry |
|
| MDP-11963 | Citreoviridin | Inquiry |
|
| MDP-23003 | Amythiamicin B | Inquiry |
|
| MDP-12314 | T-Muurolol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.