Cyclocephaloside II | CAS | 215776-78-6 |
| Molecular Weight | 827.01 |
| Formula | C43H70O15 |
| SMILES | C[C@]12[C@@]3([H])[C@@]4(CC[C@@]1([C@]([C@@]5(O[C@@H](CC5)C(C)(O)C)C)([H])[C@H](C2)O)C)[C@@]6([C@@](C(C)([C@H](CC6)O[C@H]7[C@@H]([C@H]([C@@H](CO7)OC(C)=O)O)O)C)([H])[C@H](C3)O[C@@H]8O[C@@H]([C@H]([C@@H]([C@H]8O)O)O)CO)C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14311 | (-)-Epigallocatechin-3-(3"-O-methyl) Gallate | Inquiry |
|
| PDP-13969 | Methyl Linolenate | Inquiry |
|
| PDP-13852 | (+)-Gallocatechin | Inquiry |
|
| PDP-14928 | Pinostilbene | Inquiry |
|
| PDP-15446 | Isoscutellarein | Inquiry |
|
| PDP-17621 | Inflexuside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
