Cyclo(D-Val-L-Pro) | CAS No. | 27483-18-7 |
| Molecular Weight | 196.25 |
| Formula | C10H16N2O2 |
| SMILES | O=C1N2[C@](CCC2)([H])C(N[C@@H]1C(C)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22372 | Bactobolin | Inquiry |
|
| MDP-12735 | Dihydroobionin B | Inquiry |
|
| MDP-12533 | Kapurimycin A3 | Inquiry |
|
| MDP-23075 | Deoxymulundocandin | Inquiry |
|
| MDP-11171 | L-Carnosine | Inquiry |
|
| MDP-11804 | Cyclic N-Acetyl-D-mannosamine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
