Cynaroside | Synonyms | Luteolin 7-glucoside; Luteolin 7-O-β-D-glucoside |
| Appearance | Solid |
| CAS | 5373-11-5 |
| Purity | 99.37% |
| Molecular Weight | 448.38 |
| Formula | C21H20O11 |
| Color | Light yellow to green yellow |
| SMILES | O=C(C=C(C1=CC(O)=C(O)C=C1)OC2=CC(O[C@@H]([C@@H]([C@@H](O)[C@@H]3O)O)O[C@@H]3CO)=C4)C2=C4O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18653 | Yadanzioside G | Inquiry |
|
| PDP-19312 | Hosenkoside B | Inquiry |
|
| PDP-19407 | Rocaglamide D | Inquiry |
|
| PDP-14864 | Methyl Oleanonate | Inquiry |
|
| PDP-18021 | Evodol | Inquiry |
|
| PDP-17001 | Moracin D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
