Cystothiazole B | CAS No. | 207399-38-0 |
| Molecular Weight | 438.56 |
| Formula | C20H26N2O5S2 |
| SMILES | CC(O)(C1=NC(C2=NC(/C=C/[C@H](OC)[C@@H](C)/C(OC)=C\C(OC)=O)=CS2)=CS1)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11833 | Prodigiosin Hydrochloride | Inquiry |
|
| MDP-11399 | Oxalic Acid, 99% | Inquiry |
|
| MDP-12093 | Indole (standard) | Inquiry |
|
| MDP-11100 | Xanthine | Inquiry |
|
| MDP-23621 | Concanamycin E | Inquiry |
|
| MDP-23992 | Cymbimicin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
