α-D-Galactofuranose | CAS No. | 36468-82-3 |
| Molecular Formula | C6H12O6 |
| MW | 180.16 |
| Boiling Point | 476.9±45.0ºC(lit.) |
| SMILES | C([C@H]([C@H]1[C@@H]([C@H]([C@H](O1)O)O)O)O)O |
| InchiKey | AVVWPBAENSWJCB-TVIMKVIFSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5747 | D-(-)-Gulose | Inquiry |
|
| OM-5434 | D-Lactose Monohydrate | Inquiry |
|
| OM-5376 | N-Ethyl Glucamine | Inquiry |
|
| OM-5787 | 1,3,4,6-Tetra-O-Acetyl-Beta-D-Mannopyranose | Inquiry |
|
| OM-5761 | Ribofuranose (7CI,8CI,9CI) | Inquiry |
|
| OM-5342 | Beta-D-Glucose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
