D-Phenylalanine | CAS No. | 673-06-3 |
| Purity | 99.93% |
| Molecular Weight | 165.19 |
| Formula | C9H11NO2 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | N[C@H](CC1=CC=CC=C1)C(O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23955 | Methymycin | Inquiry |
|
| MDP-22064 | Alterporriol B | Inquiry |
|
| MDP-22871 | MM 47755 | Inquiry |
|
| MDP-12601 | Asperaculane B | Inquiry |
|
| MDP-24262 | Glidobactin B | Inquiry |
|
| MDP-23504 | Asparenomycin C | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
