Dactylocycline E | CAS No. | 146064-01-9 |
| Molecular Weight | 683.10 |
| Formula | C31H39ClN2O13 |
| SMILES | O=C(C1=C(O)[C@@H](N(C)C)[C@@](CC2C(C(C3=C(O)C=C(OC)C(Cl)=C3[C@]2(O[C@H]4C[C@](C)(O)[C@@H](OC)[C@H](C)O4)C)=O)=C5O)(O)[C@@]5(O)C1=O)N |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24301 | Herbicidin B | Inquiry |
|
| MDP-23665 | Chymostatin A | Inquiry |
|
| MDP-24004 | Chandrananimycin B | Inquiry |
|
| MDP-22037 | Uridine Diphosphate Glucuronic Acid | Inquiry |
|
| MDP-11228 | NADP | Inquiry |
|
| MDP-22582 | Griseolic Acid C | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
