Danshenol A | Appearance | Solid |
| CAS | 189308-08-5 |
| Purity | 99.67% |
| Molecular Weight | 336.38 |
| Formula | C21H20O4 |
| Color | White to off-white |
| SMILES | O=C1[C@@](CC(C)=O)(O)C2=C(C3=C1[C@@H](C)CO3)C=CC4=C2C=CC=C4C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19098 | Camellianin B | Inquiry |
|
| PDP-15225 | Salviolone | Inquiry |
|
| PDP-13352 | Leonurine | Inquiry |
|
| PDP-18639 | 2,4,7-Trihydroxy-9,10-dihydrophenanthrene | Inquiry |
|
| PDP-18134 | N-trans-Feruloyl-3-methyldopamine | Inquiry |
|
| PDP-14903 | Quassin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
