Debilon | CAS | 26808-51-5 |
| Molecular Weight | 234.33 |
| Formula | C15H22O2 |
| SMILES | [H][C@@]12C(C)([C@](C[C@@H](O)C3=CC(C[C@H]([C@@]32C)C)=O)1[H])C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13865 | Tormentic Acid | Inquiry |
|
| PDP-16470 | Cucurbitacin B (Standard) | Inquiry |
|
| PDP-19587 | Epimagnolin B | Inquiry |
|
| PDP-15737 | (E)-3,4-Dimethoxycinnamic Acid | Inquiry |
|
| PDP-19404 | 22-Dehydroclerosterol | Inquiry |
|
| PDP-13950 | Beta-Eudesmol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
