Decatromicin B | CAS No. | 235097-64-0 |
| Molecular Weight | 855.84 |
| Formula | C45H56Cl2N2O10 |
| SMILES | C[C@@](C=C1C(O)=O)(/C=C(C/C=C/C[C@@](C=C2)([H])[C@@]3([C@@](CC[C@@H]4C)([H])[C@@]2([H])[C@H]4O[C@H](O[C@@H]5C)C[C@H]([C@@H]5NC(C(NC(Cl)=C6)=C6Cl)=O)O)CC)\C)[C@](C[C@@H]1CC)(O7)C(O)=C(C3=O)C7=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22907 | Tetraacetylphytosphingosine | Inquiry |
|
| MDP-23429 | Argyrin A | Inquiry |
|
| MDP-12644 | Trypacidin | Inquiry |
|
| MDP-22343 | Decarbamoylsaxitoxin | Inquiry |
|
| MDP-21915 | Banksialactone A | Inquiry |
|
| MDP-24350 | Maridomycin IV | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
