Decursin | Synonyms | (+)-Decursin |
| Appearance | Solid |
| CAS | 5928-25-6 |
| Purity | 99.99% |
| Molecular Weight | 328.36 |
| Formula | C19H20O5 |
| Color | White to off-white |
| SMILES | C/C(C)=C\C(O[C@H](C(C)(C)O1)CC2=C1C=C(O3)C(C=CC3=O)=C2)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17553 | Aconicarchamine B | Inquiry |
|
| PDP-16618 | Forskolin G | Inquiry |
|
| PDP-15599 | Kanzonol C | Inquiry |
|
| PDP-16208 | N-Formylcytisine | Inquiry |
|
| PDP-16084 | Ophiopogonin D' | Inquiry |
|
| PDP-13914 | Methyl Carnosate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
