Dehydrocrenatidine | Synonyms | Kumujian G; O-Methylpicrasidine I |
| Appearance | Solid |
| CAS | 65236-62-6 |
| Purity | ≥98.0% |
| Molecular Weight | 254.28 |
| Formula | C15H14N2O2 |
| Color | Off-white to light yellow |
| SMILES | COC1=CC=CC2=C1NC3=C2C(OC)=CN=C3C=C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15510 | Hederasaponin B | Inquiry |
|
| PDP-14212 | Asperulosidic Acid | Inquiry |
|
| PDP-16439 | Robustaflavone | Inquiry |
|
| PDP-19876 | Chebulagic Acid (Standard) | Inquiry |
|
| PDP-20414 | Ginsenoside Rb2 (Standard) | Inquiry |
|
| PDP-17545 | Triptoquinone B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
