Dehydroevodiamine | Appearance | Solid |
| CAS | 67909-49-3 |
| Purity | 99.93% |
| Molecular Weight | 301.34 |
| Formula | C19H15N3O |
| Color | Light yellow to yellow |
| SMILES | O=C1N2C(C([N-]C3=C4C=CC=C3)=C4CC2)=[N+](C)C5=C1C=CC=C5 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18075 | Betulin Caffeate | Inquiry |
|
| PDP-16895 | Typhatifolin B | Inquiry |
|
| PDP-19120 | 3-Oxobetulin | Inquiry |
|
| PDP-14710 | Macurin | Inquiry |
|
| PDP-15861 | Yunaconitine | Inquiry |
|
| PDP-17308 | Pipercide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
