Dehydroglaucine | Appearance | Solid |
| CAS | 22212-26-6 |
| Purity | 98.49% |
| Molecular Weight | 353.41 |
| Formula | C21H23NO4 |
| Color | Off-white to light yellow |
| SMILES | CN1CCC2=CC(OC)=C(OC)C3=C4C(C=C(OC)C(OC)=C4)=CC1=C23 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19744 | Daphnetin (Standard) | Inquiry |
|
| PDP-15723 | 6"-O-Acetylgenistin | Inquiry |
|
| PDP-14670 | Kalii Dehydrographolidi Succinas | Inquiry |
|
| PDP-18046 | Vitexin B-1 | Inquiry |
|
| PDP-13440 | Daphnetin | Inquiry |
|
| PDP-13731 | Auraptene | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
