Delavinone | Synonyms | Sinpeinine A |
| CAS | 96997-98-7 |
| Molecular Weight | 413.64 |
| Formula | C27H43NO2 |
| SMILES | C[C@]1([C@]2([H])C[C@@H](O)CC1)[C@]3([H])[C@](CC2=O)([H])[C@@]4([H])[C@@]([C@@]5([H])[C@@]([C@H]([C@@]6([H])N(C[C@@H](C)CC6)C5)C)([H])CC4)([H])C3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19644 | alpha-Hederin (Standard) | Inquiry |
|
| PDP-19823 | Alisol B 23-acetate (Standard) | Inquiry |
|
| PDP-15801 | Raloxifene (Hydrochloride) (Standard) | Inquiry |
|
| PDP-17308 | Pipercide | Inquiry |
|
| PDP-19237 | Conduritol A | Inquiry |
|
| PDP-14471 | Zingiberen Newsaponin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
