Delphinidin 3-glucoside Chloride | CAS No. | 6906-38-3 |
| Purity | 99.89% |
| Synonyms | Delphinidin 3-O-glucoside Chloride; Delphinidin 3-O-β-glucoside Chloride |
| Molecular Weight | 500.84 |
| Formula | C21H21ClO12 |
| Appearance | Solid |
| Color | Purple to black |
| SMILES | OC1=CC(O)=CC2=C1C=C(C(C3=CC(O)=C(C(O)=C3)O)=[O+]2)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO.[Cl-] |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
-20°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23643 | Eupenoxide | Inquiry |
|
| MDP-11449 | D-Erythrose | Inquiry |
|
| MDP-22147 | Malolactomycin C | Inquiry |
|
| MDP-22105 | Protactin | Inquiry |
|
| MDP-24105 | 3-O-Demethyl-2'-N-glylfortimicin B | Inquiry |
|
| MDP-22756 | Trichaspside F | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
