Demethoxydeacetoxypseudolaric Acid B | Synonyms | Deacetyldemethylpseudolaric Acid B |
| Appearance | Solid |
| CAS | 82508-36-9 |
| Purity | 99.94% |
| Molecular Weight | 376.4 |
| Formula | C20H24O7 |
| Color | White to off-white |
| SMILES | O[C@]12[C@@]3(CC=C(CC2)C(O)=O)C(O[C@@](C)([C@@H]1CC3)/C=C/C=C(C)/C(O)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16235 | Regaloside H | Inquiry |
|
| PDP-14662 | Makisterone A | Inquiry |
|
| PDP-13369 | AKBA | Inquiry |
|
| PDP-17626 | Nodakenetin-Glucose-malonic Acid | Inquiry |
|
| PDP-18371 | Euxanthone | Inquiry |
|
| PDP-20260 | Methyl Pentacosanoate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
