Demethylcarolignan E | Synonyms | Carolignan M |
| CAS | 873694-46-3 |
| Molecular Weight | 716.73 |
| Formula | C39H40O13 |
| SMILES | O=C(OC[C@H](OC1=CC=C(CCCOC(/C=C/C2=CC=C(O)C(OC)=C2)=O)C=C1O)[C@@H](O)C3=CC=C(O)C(OC)=C3)/C=C/C4=CC=C(O)C(OC)=C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17837 | Ginsenoside Rs1 | Inquiry |
|
| PDP-15693 | N,N'-Diferuloylputrescine | Inquiry |
|
| PDP-18599 | 11-Oxomogroside IIe | Inquiry |
|
| PDP-14501 | D-(+)-Melezitose | Inquiry |
|
| PDP-16475 | Icariside E5 | Inquiry |
|
| PDP-19291 | 23-O-β-D-Glucopyranosyl-20-isoveratramine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
