Deserpidine | Synonyms | Harmonyl |
| Appearance | Solid |
| CAS | 131-01-1 |
| Purity | 98.78% |
| Molecular Weight | 578.65 |
| Formula | C32H38N2O8 |
| Color | White to light yellow |
| SMILES | COC([C@H]1[C@@]2([H])C[C@]3([H])C4=C(CCN3C[C@@]2([H])C[C@@H](OC(C5=CC(OC)=C(OC)C(OC)=C5)=O)[C@@H]1OC)C6=CC=CC=C6N4)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13065 | Natural Licorice Extract | Inquiry |
|
| PDP-15855 | Asiaticoside B | Inquiry |
|
| PDP-14230 | Emodin-8-glucoside | Inquiry |
|
| PDP-19266 | Amorfrutin B | Inquiry |
|
| PDP-15606 | Ginsenoside Rh7 | Inquiry |
|
| PDP-19088 | 1,7-Dihydroxy-2,3-dimethoxyxanthone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
