Desertomycin B | CAS No. | 143629-44-1 |
| Molecular Weight | 1191.48 |
| Formula | C61H106O22 |
| SMILES | OC[C@H]([C@H]([C@@H]([C@@H]1O)O)O)O[C@@H]1O[C@H]2/C=C([C@@H]([C@H](/C=C/[C@@H]([C@H](/C=C/CC[C@@H]([C@@H]([C@@H]([C@H](CC/C=C(C(O[C@](C/C=C/[C@H](C[C@@H](C[C@H]([C@@H]([C@@H]([C@H]([C@H](C[C@H](C[C@@H](C[C@H]2O)O)O)O)C)O)C)O)O)O)([H])[C@@H]([C@]3([H])OC(CC3)O)C)=O)\C)C)O)C)O)C)O)C)O)\C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24226 | 1-Hydroxy-2-nonyn-4-one | Inquiry |
|
| MDP-22830 | Cryptosporioptide A | Inquiry |
|
| MDP-23674 | γ-Decalactone (Standard) | Inquiry |
|
| MDP-23454 | Alliacol B | Inquiry |
|
| MDP-23887 | Seitomycin | Inquiry |
|
| MDP-11137 | 7-Dehydrocholesterol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
