Dicentrine | Appearance | Solid |
| CAS | 517-66-8 |
| Purity | 99.94% |
| Molecular Weight | 339.39 |
| Formula | C20H21NO4 |
| Color | Off-white to light brown |
| SMILES | CN1[C@]2([H])C3=C(C4=C(OCO4)C=C3CC1)C5=C(C=C(OC)C(OC)=C5)C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18388 | Garciniaxanthone E | Inquiry |
|
| PDP-18481 | Perisesaccharide B | Inquiry |
|
| PDP-16532 | (-)-Zuonin A | Inquiry |
|
| PDP-20578 | Sesamol (Standard) | Inquiry |
|
| PDP-19564 | (3R)-7,4’-Dihydrohomoisoflavanone | Inquiry |
|
| PDP-16553 | Seneganolide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
