(-)-Dihydrocarveol | CAS No. | 20549-47-7 |
| Molecular Weight | 154.25 |
| Formula | C10H18O |
| SMILES | CC([C@H]1C[C@H]([C@@H](CC1)C)O)=C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-21940 | Malformin A1 | Inquiry |
|
| MDP-11834 | Succinic Acid (standard) | Inquiry |
|
| MDP-21881 | Integracin B | Inquiry |
|
| MDP-12344 | Chlorogenic Acid (Standard) | Inquiry |
|
| MDP-12780 | Rubropunctamine | Inquiry |
|
| MDP-23705 | Lactoquinomycin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
