Dihydrochelerythrine | Synonyms | 12,13-Dihydrochelerythrine |
| Appearance | Solid |
| CAS | 6880-91-7 |
| Purity | 99.39% |
| Molecular Weight | 349.38 |
| Formula | C21H19NO4 |
| Color | White to off-white |
| SMILES | CN1C(C2=CC(OCO3)=C3C=C2C=C4)=C4C5=CC=C(OC)C(OC)=C5C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17509 | Dihydroisocucurbitacin B | Inquiry |
|
| PDP-17850 | (20S)-18,19-Dehydrocamptothecin | Inquiry |
|
| PDP-20004 | Protoescigenin (Standard) | Inquiry |
|
| PDP-13192 | Daidzin | Inquiry |
|
| PDP-17086 | Longiferone B | Inquiry |
|
| PDP-18390 | Garjasmin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
