Dihydrochelirubine | CAS | 28342-26-9 |
| Molecular Weight | 363.36 |
| Formula | C21H17NO5 |
| SMILES | CN1C2=C(C=CC3=CC4=C(C=C32)OCO4)C5=C(C=C6OCOC6=C5C1)OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13574 | Jujuboside A | Inquiry |
|
| PDP-16050 | Sibiricaxanthone B | Inquiry |
|
| PDP-14692 | Mogroside IV-A | Inquiry |
|
| PDP-17254 | 6-O-Methylcatalpol | Inquiry |
|
| PDP-19837 | (-)-Anomalin (Standard) | Inquiry |
|
| PDP-13615 | L-Perillaldehyde | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
