Dihydrocucurbitacin B | Appearance | Solid |
| CAS | 13201-14-4 |
| Molecular Weight | 560.72 |
| Formula | C32H48O8 |
| Color | White to off-white |
| SMILES | C[C@]12[C@@]([C@]([C@@](C)(O)C(CCC(C)(C)OC(C)=O)=O)([H])[C@H](O)C1)(CC([C@]3(C)[C@@]2([H])CC=C(C4(C)C)[C@@]3([H])C[C@H](O)C4=O)=O)C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19925 | Convallatoxin (Standard) | Inquiry |
|
| PDP-17893 | 16-Anhydrodeacetylnerigoside | Inquiry |
|
| PDP-16444 | (E)-Cinnamamide | Inquiry |
|
| PDP-19811 | Mesaconitine (Standard) | Inquiry |
|
| PDP-14529 | Casanthranol | Inquiry |
|
| PDP-17022 | 7-Deacetylgedunin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
