Dihydromyricetin | Synonyms | Ampelopsin; Ampeloptin |
| Appearance | Solid |
| CAS | 27200-12-0 |
| Purity | 99.73% |
| Molecular Weight | 320.25 |
| Formula | C15H12O8 |
| Color | White to off-white |
| SMILES | O=C1[C@H](O)[C@@H](C2=CC(O)=C(O)C(O)=C2)OC3=CC(O)=CC(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 1 year; -20°C 6 months |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19897 | Sibiricose A5 (Standard) | Inquiry |
|
| PDP-13297 | Betulin | Inquiry |
|
| PDP-20385 | Kaempferide (Standard) | Inquiry |
|
| PDP-16666 | Tropolone | Inquiry |
|
| PDP-14341 | 4-Hydroxyisoleucine | Inquiry |
|
| PDP-18067 | Aristolactam A IIIa | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
