Dihydronovobiocin | CAS No. | 29826-16-2 |
| Molecular Weight | 614.64 |
| Formula | C31H38N2O11 |
| SMILES | CC1=C2C(C(O)=C(C(O2)=O)NC(C3=CC(CCC(C)C)=C(C=C3)O)=O)=CC=C1O[C@H]4[C@@H]([C@@H]([C@H](C(C)(O4)C)OC)OC(N)=O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23028 | Dactylocycline B | Inquiry |
|
| MDP-23031 | Virginiamycin S1 (Standard) | Inquiry |
|
| MDP-11490 | L-Ascorbic Acid (Standard) | Inquiry |
|
| MDP-12643 | Agonodepside B | Inquiry |
|
| MDP-11001 | Adenosine Monophosphate | Inquiry |
|
| MDP-22624 | Aminoadipic Acid (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
