Dihydrotetrodecamycin | CAS No. | 166403-10-7 |
| Molecular Weight | 336.38 |
| Formula | C18H24O6 |
| SMILES | C[C@@H]1[C@H]2[C@@H](O)[C@]3(O)CCCC[C@@]3([H])[C@]1(C)C(C4=C([C@H](C)OC4=O)O2)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-10957 | Pepstatin | Inquiry |
|
| MDP-22226 | Bacteriopheophytin | Inquiry |
|
| MDP-22805 | 5'-Methylthioadenosine (Standard) | Inquiry |
|
| MDP-12443 | Erinacin B | Inquiry |
|
| MDP-23865 | 5-Hydroxy-4-oxo-L-norvaline | Inquiry |
|
| MDP-22920 | Rubradirin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
