DL-Xylose | Synonyms | (±)-Xylos |
| Appearance | Solid |
| CAS | 25990-60-7 |
| Purity | ≥98.0% |
| Molecular Weight | 150.13 |
| Formula | C5H10O5 |
| Color | White to off-white |
| SMILES | O=C[C@@H]([C@H]([C@@H](CO)O)O)O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15738 | Tigogenin | Inquiry |
|
| PDP-13164 | Salvianolic Acid B | Inquiry |
|
| PDP-15418 | Triamcinolone (Standard) | Inquiry |
|
| PDP-17663 | Rhamnetin 3-O-β-D-glucopyranoside | Inquiry |
|
| PDP-18705 | Baccatin VI | Inquiry |
|
| PDP-15730 | Pangelin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
