(E)-Coniferin | Synonyms | (E)-Laricin |
| CAS | 124151-33-3 |
| Molecular Weight | 342.34 |
| Formula | C16H22O8 |
| SMILES | COC(C=C(/C=C/CO)C=C1)=C1O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CO.[E] |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17137 | Cucurbitacin S | Inquiry |
|
| PDP-18268 | Carpachromene | Inquiry |
|
| PDP-19212 | Polyphyllin F | Inquiry |
|
| PDP-16802 | Atranorin (Standard) | Inquiry |
|
| PDP-17615 | erythro-Austrobailignan-6 | Inquiry |
|
| PDP-19425 | 1β-Hydroxy-4(15),5E,10(14)-germacratriene | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
