(E)-Methyl 3,4,5-trimethoxycinnamate | CAS | 20329-96-8 |
| Molecular Weight | 252.26 |
| Formula | C13H16O5 |
| SMILES | O=C(OC)/C=C/C1=CC(OC)=C(OC)C(OC)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15900 | 3-Methylcarbazole | Inquiry |
|
| PDP-12991 | Gardenia Green Colorant | Inquiry |
|
| PDP-13303 | Ginkgolide B | Inquiry |
|
| PDP-16770 | Methyl Pheophorbide A | Inquiry |
|
| PDP-19607 | Valeriandoid F | Inquiry |
|
| PDP-14769 | Asaraldehyde | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
