(E)-tri-Pcoumaroylspermidine | CAS | 131086-78-7 |
| Molecular Weight | 583.67 |
| Formula | C34H37N3O6 |
| SMILES | O=C(N(CCCCNC(/C=C/C1=CC=C(O)C=C1)=O)CCCNC(/C=C/C2=CC=C(O)C=C2)=O)/C=C/C3=CC=C(O)C=C3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16579 | Withaphysalin E | Inquiry |
|
| PDP-18720 | Senecionine Acetate | Inquiry |
|
| PDP-14238 | Cyclen | Inquiry |
|
| PDP-17867 | Tricetin 7-O-glucoside | Inquiry |
|
| PDP-20314 | Isonicotinic Acid (Standard) | Inquiry |
|
| PDP-14512 | Loureirin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
