Ecteinascidin 770 | CAS No. | 114899-80-8 |
| Purity | 99.81% |
| Synonyms | Ecteinascidine 770; Et-770 |
| Molecular Weight | 770.85 |
| Formula | C40H42N4O10S |
| Appearance | Solid |
| Color | White to yellow |
| SMILES | N#C[C@@H]([C@@]1([H])N(C)[C@]2([H])C3=C(C=C(C)C(OC)=C3O)C1)N4[C@@]2([H])[C@@](SC[C@@]5(NCC6)C7=C6C=C(O)C(OC)=C7)([H])C8=C(C(OCO9)=C9C(C)=C8OC(C)=O)[C@]4([H])COC5=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
-20°C, protect from light, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24095 | Halymecin D | Inquiry |
|
| MDP-21885 | Kipukasin D | Inquiry |
|
| MDP-24348 | Roseorubicin B | Inquiry |
|
| MDP-12581 | Amphotericin B Trihydrate | Inquiry |
|
| MDP-24152 | Scytalol D | Inquiry |
|
| MDP-24005 | Stambomycin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
