β-Elemene | Synonyms | (-)-β-Elemene; Levo-β-elemene |
| Appearance | Liquid (Density: 0.862 g/cm3) |
| CAS | 515-13-9 |
| Purity | 99.62% |
| Molecular Weight | 204.35 |
| Formula | C15H24 |
| Color | Colorless to light yellow |
| SMILES | CC([C@H]1[C@@](C)(CC[C@@H](C(C)=C)C1)C=C)=C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (stored under nitrogen) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17408 | 5,4'-Dihydroxy-7-methoxy-6-methylflavane | Inquiry |
|
| PDP-13456 | Fagomine | Inquiry |
|
| PDP-15638 | Choerospondin | Inquiry |
|
| PDP-20398 | Pyrrole-2-carboxaldehyde (Standard) | Inquiry |
|
| PDP-19214 | 7-Hydroxyflavanone | Inquiry |
|
| PDP-15443 | Aloin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
