Ellipticine Hydrochloride | Synonyms | NSC 71795 Hydrochloride |
| Appearance | Solid |
| CAS | 5081-48-1 |
| Purity | 99.34% |
| Molecular Weight | 282.77 |
| Formula | C17H15ClN2 |
| Color | Light yellow to yellow |
| SMILES | CC1=C(C=NC=C2)C2=C(C)C(N3)=C1C4=C3C=CC=C4.Cl |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16804 | Arecoline Hydrochloride | Inquiry |
|
| PDP-14049 | 7-epi-Taxol | Inquiry |
|
| PDP-13303 | Ginkgolide B | Inquiry |
|
| PDP-20116 | (1,5E,11E)-Tridecatriene-7,9-diyne-3,4-diacetate | Inquiry |
|
| PDP-15222 | Agathisflavone | Inquiry |
|
| PDP-16110 | Acanthopanaxoside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
