Elsamicin B | CAS No. | 97068-31-0 |
| Molecular Weight | 494.45 |
| Formula | C26H22O10 |
| SMILES | OC(C1=C2C3=C(OC1=O)C=CC(C)=C34)=C(C=CC=C5O[C@H]6[C@@H]([C@@](O)([C@H]([C@H](O6)C)O)C)O)C5=C2OC4=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11338 | Hydrocinnamic Acid | Inquiry |
|
| MDP-23382 | Natamycin (Standard) | Inquiry |
|
| MDP-24197 | Glucolipsin B | Inquiry |
|
| MDP-22665 | Taurodeoxycholic Acid (Standard) | Inquiry |
|
| MDP-12645 | Varioxepine A | Inquiry |
|
| MDP-22584 | (rel)-Asperparaline A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
