Enactin Ⅰb | CAS No. | 137252-26-7 |
| Molecular Weight | 402.53 |
| Formula | C20H38N2O6 |
| SMILES | O=C(CCCCCCC(CCCC(C(C)O)C)=O)CCN(C(C(CO)N)=O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12619 | Canadensolide | Inquiry |
|
| MDP-23708 | 7-Hydroxyguanine | Inquiry |
|
| MDP-23531 | Nocapyrone Q | Inquiry |
|
| MDP-22341 | Piperafizine B | Inquiry |
|
| MDP-23021 | D-Tagatose (Standard) | Inquiry |
|
| MDP-24293 | Cladospolide D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
