Enactin Ia | CAS No. | 130640-30-1 |
| Molecular Weight | 402.53 |
| Formula | C20H38N2O6 |
| SMILES | CC(C)(O)CCCCC(CCCCCCC(CCN(O)C([C@@H](N)CO)=O)=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11197 | Ergosterol | Inquiry |
|
| MDP-23441 | Isariin B | Inquiry |
|
| MDP-11832 | Fusicoccin | Inquiry |
|
| MDP-23482 | Astechrome | Inquiry |
|
| MDP-12061 | Octyl Acetate | Inquiry |
|
| MDP-12726 | Sadopeptins B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
